ChemNet > CAS > 117-18-0 2,3,5,6-Tetrachloronitrobenzene
117-18-0 2,3,5,6-Tetrachloronitrobenzene
| اسم المنتج |
2,3,5,6-Tetrachloronitrobenzene |
| الاسم المستعار |
1,2,4,5-Tetrachloro-3-nitrobenzene; tecnazene; 3-Nitro-1,2,4,5-tetrachlorobenzene; Tecnazene; 1,2,3,4,5-pentachloro-6-nitrobenzene; 1,2,3,4-Tetrachloro-3-Nitrobenzene; Fumite(R); Fusarex(R); LABOTEST-BB LT00152717 |
| الصيغة الجزيئية |
C6HCl4NO2 |
| الوزن الجزيئي الغرامي |
260.8896 |
| InChI |
InChI=1/C6HCl4NO2/c7-2-1-3(8)5(10)6(4(2)9)11(12)13/h1H |
| إستراتيجية المساعدة القطرية |
117-18-0 |
| المفوضية الأوروبية رقم |
204-178-2 |
| بنية جزيئية |
|
| كثافة |
1.75g/cm3 |
| درجة الإنصهار |
98-101℃ |
| نقطة الغليان |
304°C at 760 mmHg |
| معامل الإنكسار |
1.62 |
| نقطة الوميض |
143.1°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
 N:Dangerous for the environment;
|
| خطر المصطلحات |
R22:Harmful if swallowed.;
R43:May cause sensitization by skin contact.;
R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| شروط الأمن |
S24:Avoid contact with skin.;
S37:Wear suitable gloves.;
S60:This material and its container must be disposed of as hazardous waste.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
