ChemNet > CAS > 120-61-6 Dimethyl terephthalate
120-61-6 Dimethyl terephthalate
| اسم المنتج |
Dimethyl terephthalate |
| الاسم المستعار |
D.M.T.; Terephthalic acid dimethyl ester; Benzene-1,4-dicarboxylic acid dimethyl ester; Terephthalic acid dimethyl ester; dimethyl cyclohexane-1,4-dicarboxylate; 1,3-benzodioxol-5-yl methylcarbamate; dimethyl benzene-1,4-dicarboxylate; 4-(methoxycarbonyl)benzoic acid; dimethyl benzene-1,2-dicarboxylate; DMT |
| الصيغة الجزيئية |
C10H10O4 |
| الوزن الجزيئي الغرامي |
194.184 |
| InChI |
InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
| إستراتيجية المساعدة القطرية |
120-61-6 |
| المفوضية الأوروبية رقم |
204-411-8 |
| بنية جزيئية |
|
| كثافة |
1.175g/cm3 |
| درجة الإنصهار |
140-143℃ |
| نقطة الغليان |
282.7°C at 760 mmHg |
| معامل الإنكسار |
1.514 |
| نقطة الوميض |
146.7°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|
