ChemNet > CAS > 13191-36-1 2,5-Dibromo-3-methylthiophene
13191-36-1 2,5-Dibromo-3-methylthiophene
اسم المنتج |
2,5-Dibromo-3-methylthiophene |
الاسم بالانجليزية |
2,5-Dibromo-3-methylthiophene; |
الصيغة الجزيئية |
C5H4Br2S |
الوزن الجزيئي الغرامي |
255.9583 |
InChI |
InChI=1/C5H4Br2S/c1-3-2-4(6)8-5(3)7/h2H,1H3 |
إستراتيجية المساعدة القطرية |
13191-36-1 |
المفوضية الأوروبية رقم |
236-147-4 |
بنية جزيئية |
|
كثافة |
2.006g/cm3 |
نقطة الغليان |
230.2°C at 760 mmHg |
معامل الإنكسار |
1.62 |
نقطة الوميض |
93°C |
ضغط البخار |
0.101mmHg at 25°C |
خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|