ChemNet > CAS > 13194-68-8 4-iodo-2-methylaniline
13194-68-8 4-iodo-2-methylaniline
اسم المنتج |
4-iodo-2-methylaniline |
الاسم المستعار |
2-Amino-5-iodotoluene; 4-Iodo-o-toluidine; 4-Iodo-o-toluidine (NH2=1) |
الصيغة الجزيئية |
C7H8IN |
الوزن الجزيئي الغرامي |
233.0496 |
InChI |
InChI=1/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
إستراتيجية المساعدة القطرية |
13194-68-8 |
المفوضية الأوروبية رقم |
236-154-2 |
بنية جزيئية |
|
كثافة |
1.791g/cm3 |
درجة الإنصهار |
86-89℃ |
نقطة الغليان |
278.4°C at 760 mmHg |
معامل الإنكسار |
1.663 |
نقطة الوميض |
122.1°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|