| اسم المنتج |
DL-Tartaric Acid |
| الاسم المستعار |
DL-Dihydroxysuccinic acid; DL-Tartaric acid anhydrous; DL-Tartaric Acid Anhy; (+-)-Tartaric acid; (2RS,3RS)-Tartaric acid; Butanedioic acid, 2,3-dihydroxy-, (R*,R*)-; DL-Tartrate; Paratartaric aicd; Racemic tartaric acid; Resolvable tartaric acid; Uvic acid; Butanedioic acid, 2,3-dihydroxy-, (2R,3R)-rel-; Butanedioic acid, 2,3-dihydroxy-, (theta,theta)-(+-)-; (2S,3S)-2,3-dihydroxybutanedioic acid; (2R,3R)-2,3-dihydroxybutanedioic acid; DL TARTARIC ACID |
| الصيغة الجزيئية |
C4H6O6 |
| الوزن الجزيئي الغرامي |
150.0868 |
| InChI |
InChI=1/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 |
| إستراتيجية المساعدة القطرية |
133-37-9;138508-61-9 |
| المفوضية الأوروبية رقم |
205-105-7 |
| بنية جزيئية |
|
| كثافة |
1.886g/cm3 |
| درجة الإنصهار |
206℃ |
| نقطة الغليان |
399.3°C at 760 mmHg |
| معامل الإنكسار |
1.585 |
| نقطة الوميض |
209.4°C |
| الذوبان في الماء |
soluble; 20.6(20℃) |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:;
S37:;
S39:;
|
|
