ChemNet > CAS > 1483-72-3 Diphenyliodonium chloride
1483-72-3 Diphenyliodonium chloride
اسم المنتج |
Diphenyliodonium chloride |
الاسم المستعار |
Iodonium, diphenyl-, chloride (1:1); AI3-17092; NSC 134275; Iodonium, diphenyl-, chloride |
الصيغة الجزيئية |
C12H10I |
الوزن الجزيئي الغرامي |
281.11227 |
InChI |
InChI=1/C12H10I/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H/q-1 |
إستراتيجية المساعدة القطرية |
1483-72-3 |
المفوضية الأوروبية رقم |
216-049-8 |
بنية جزيئية |
|
درجة الإنصهار |
227-235℃ |
علامات على البضائع الخطرة |
T:Toxic;
|
خطر المصطلحات |
R25:Toxic if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
S37/39:Wear suitable gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|