ChemNet > CAS > 151412-02-1 2,3,6-trifluorobenzyl bromide
151412-02-1 2,3,6-trifluorobenzyl bromide
| اسم المنتج |
2,3,6-trifluorobenzyl bromide |
| الاسم المستعار |
alpha-Bromo-2,3,6-trifluorotoluene; 2-(bromomethyl)-1,3,4-trifluorobenzene; 1-(bromomethyl)-2-fluoro-3-methylbenzene |
| الصيغة الجزيئية |
C8H8BrF |
| الوزن الجزيئي الغرامي |
203.0515 |
| InChI |
InChI=1/C8H8BrF/c1-6-3-2-4-7(5-9)8(6)10/h2-4H,5H2,1H3 |
| إستراتيجية المساعدة القطرية |
151412-02-1 |
| بنية جزيئية |
|
| كثافة |
1.456g/cm3 |
| درجة الإنصهار |
114-46℃ |
| نقطة الغليان |
211.6°C at 760 mmHg |
| معامل الإنكسار |
1.539 |
| نقطة الوميض |
84.5°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
