ChemNet > CAS > 15329-69-8 N-Benzylmaleamic acid
15329-69-8 N-Benzylmaleamic acid
اسم المنتج |
N-Benzylmaleamic acid |
الاسم المستعار |
Maleic acid monobenzylamide; 4-(benzylamino)-4-oxobut-2-enoic acid; (2Z)-4-(benzylamino)-4-oxobut-2-enoic acid; (2E)-4-(benzylamino)-4-oxobut-2-enoate |
الصيغة الجزيئية |
C11H10NO3 |
الوزن الجزيئي الغرامي |
204.2025 |
InChI |
InChI=1/C11H11NO3/c13-10(6-7-11(14)15)12-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,13)(H,14,15)/p-1/b7-6+ |
إستراتيجية المساعدة القطرية |
15329-69-8 |
المفوضية الأوروبية رقم |
239-361-6 |
بنية جزيئية |
|
درجة الإنصهار |
136-138℃ |
نقطة الغليان |
476.3°C at 760 mmHg |
نقطة الوميض |
241.9°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|