ChemNet > CAS > 15414-98-9 Triphenylcarbenium pentachlorostannate
15414-98-9 Triphenylcarbenium pentachlorostannate
اسم المنتج |
Triphenylcarbenium pentachlorostannate |
الاسم المستعار |
Trityl pentachlorostannate; tin(4+) triphenylmethylium chloride (1:1:5) |
الصيغة الجزيئية |
C19H15Cl5Sn |
الوزن الجزيئي الغرامي |
539.2974 |
InChI |
InChI=1/C19H15.5ClH.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;/h1-15H;5*1H;/q+1;;;;;;+4/p-5 |
إستراتيجية المساعدة القطرية |
15414-98-9 |
المفوضية الأوروبية رقم |
239-426-9 |
بنية جزيئية |
|
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|