ChemNet > CAS > 166330-10-5 Bis(2-diphenylphosphinophenyl)ether
166330-10-5 Bis(2-diphenylphosphinophenyl)ether
| اسم المنتج |
Bis(2-diphenylphosphinophenyl)ether |
| الاسم بالانجليزية |
Bis(2-diphenylphosphinophenyl)ether; Bisdiphenylphosphinophenylether; (Oxydi-2,1-phenylene)-bis-(diphenylphosphine); (oxydi-2,1-phenylene)bis(diphenylphosphine); [2-(2-diphenylphosphanylphenoxy)phenyl]-diphenyl-phosphane; DPEPhos |
| الصيغة الجزيئية |
C36H28OP2 |
| الوزن الجزيئي الغرامي |
538.5544 |
| InChI |
InChI=1/C36H28OP2/c1-5-17-29(18-6-1)38(30-19-7-2-8-20-30)35-27-15-13-25-33(35)37-34-26-14-16-28-36(34)39(31-21-9-3-10-22-31)32-23-11-4-12-24-32/h1-28H |
| إستراتيجية المساعدة القطرية |
166330-10-5 |
| بنية جزيئية |
|
| درجة الإنصهار |
184-187℃ |
| نقطة الغليان |
608.19°C at 760 mmHg |
| نقطة الوميض |
404.905°C |
| ضغط البخار |
0mmHg at 25°C |
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|