ChemNet > CAS > 1673-47-8 3-Chlorobenzhydrazide
1673-47-8 3-Chlorobenzhydrazide
اسم المنتج |
3-Chlorobenzhydrazide |
الاسم المستعار |
3-Chlorobenzhydrazide, (3-Chlorobenzoic acid hydrazide); SPECS AN-068/40169986; ASISCHEM D51116; 3-CHLOROBENZOIC HYDRAZIDE; 3-CHLOROBENZOIC ACID HYDRAZIDE; 3-CHLOROBENZENE-1-CARBOHYDRAZIDE; AKOS BBS-00004508; Benzoic acid, 3-chloro-, hydrazide; 3-chlorobenzohydrazide |
الصيغة الجزيئية |
C7H7ClN2O |
الوزن الجزيئي الغرامي |
170.5963 |
InChI |
InChI=1/C7H7ClN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
إستراتيجية المساعدة القطرية |
1673-47-8 |
المفوضية الأوروبية رقم |
216-812-5 |
بنية جزيئية |
|
كثافة |
1.323g/cm3 |
نقطة الغليان |
350.4°C at 760 mmHg |
معامل الإنكسار |
1.592 |
نقطة الوميض |
165.7°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|