ChemNet > CAS > 1731-79-9 dimethyl dodecanedioate
1731-79-9 dimethyl dodecanedioate
اسم المنتج |
dimethyl dodecanedioate |
الاسم المستعار |
Dimethyl 1,10-decanedicarboxylate; 1,10-Decanedicarboxylic acid dimethyl ester~Dodecanedioic acid dimethyl ester; Dodecanedioic acid dimethyl ester; N-(2-Chloroethyl) Pyrrolinie HCl |
الصيغة الجزيئية |
C14H26O4 |
الوزن الجزيئي الغرامي |
258.3538 |
InChI |
InChI=1/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
إستراتيجية المساعدة القطرية |
1731-79-9 |
المفوضية الأوروبية رقم |
217-050-6 |
بنية جزيئية |
|
كثافة |
0.969g/cm3 |
نقطة الغليان |
300.9°C at 760 mmHg |
معامل الإنكسار |
1.441 |
نقطة الوميض |
135°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|