1732-08-7 Dimethyl pimelate
اسم المنتج |
Dimethyl pimelate |
الاسم بالانجليزية |
Dimethyl pimelate; Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
الصيغة الجزيئية |
C9H16O4 |
الوزن الجزيئي الغرامي |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
إستراتيجية المساعدة القطرية |
1732-08-7 |
المفوضية الأوروبية رقم |
217-057-4 |
بنية جزيئية |
|
كثافة |
1.022g/cm3 |
نقطة الغليان |
250.3°C at 760 mmHg |
معامل الإنكسار |
1.427 |
نقطة الوميض |
105.4°C |
ضغط البخار |
0.0219mmHg at 25°C |
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|