ChemNet > CAS > 208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
اسم المنتج |
4-fluoro-2-(trifluoromethyl)acetophenone |
الاسم المستعار |
4'-fluoro-2'-(trifluoromethyl)acetophenone; 1-[4-fluoro-2-(trifluoromethyl)phenyl]ethanone; 4'-Fluoro-2'-trifluoromethylacetophenone; 4-Fluoro-2-trifluoromethylacetophenone |
الصيغة الجزيئية |
C9H9FO2 |
الوزن الجزيئي الغرامي |
168.165 |
InChI |
InChI=1/C9H9FO2/c1-6(11)7-3-4-8(10)9(5-7)12-2/h3-5H,1-2H3 |
إستراتيجية المساعدة القطرية |
208173-21-1 |
بنية جزيئية |
|
كثافة |
1.127g/cm3 |
نقطة الغليان |
246°C at 760 mmHg |
معامل الإنكسار |
1.487 |
نقطة الوميض |
99.6°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|