ChemNet > CAS > 216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
اسم المنتج |
4-Bromo-2-fluorobenzeneboronic acid |
الاسم المستعار |
4-Bromo-2-fluorophenylboronic acid |
الصيغة الجزيئية |
C6H5BBrFO2 |
الوزن الجزيئي الغرامي |
218.8161 |
InChI |
InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
إستراتيجية المساعدة القطرية |
216393-64-5 |
بنية جزيئية |
|
كثافة |
1.75g/cm3 |
نقطة الغليان |
310.6°C at 760 mmHg |
معامل الإنكسار |
1.571 |
نقطة الوميض |
141.6°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|