2444-37-3 (Methylthio)acetic acid
اسم المنتج |
(Methylthio)acetic acid |
الاسم بالانجليزية |
(Methylthio)acetic acid; NSC 263480; (methylsulfanyl)acetic acid |
الصيغة الجزيئية |
C3H6O2S |
الوزن الجزيئي الغرامي |
106.1435 |
InChI |
InChI=1/C3H6O2S/c1-6-2-3(4)5/h2H2,1H3,(H,4,5) |
إستراتيجية المساعدة القطرية |
2444-37-3 |
المفوضية الأوروبية رقم |
219-483-6 |
بنية جزيئية |
|
كثافة |
1.224g/cm3 |
درجة الإنصهار |
13-131℃ |
نقطة الغليان |
225.9°C at 760 mmHg |
معامل الإنكسار |
1.5 |
نقطة الوميض |
90.4°C |
ضغط البخار |
0.0307mmHg at 25°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|