ChemNet > CAS > 2444-37-3 (Methylthio)acetic acid
2444-37-3 (Methylthio)acetic acid
| اسم المنتج |
(Methylthio)acetic acid |
| الاسم المستعار |
NSC 263480; (methylsulfanyl)acetic acid |
| الصيغة الجزيئية |
C3H6O2S |
| الوزن الجزيئي الغرامي |
106.1435 |
| InChI |
InChI=1/C3H6O2S/c1-6-2-3(4)5/h2H2,1H3,(H,4,5) |
| إستراتيجية المساعدة القطرية |
2444-37-3 |
| المفوضية الأوروبية رقم |
219-483-6 |
| بنية جزيئية |
|
| كثافة |
1.224g/cm3 |
| درجة الإنصهار |
13-131℃ |
| نقطة الغليان |
225.9°C at 760 mmHg |
| معامل الإنكسار |
1.5 |
| نقطة الوميض |
90.4°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
