ChemNet > CAS > 2471-70-7 6-methoxy-2-naphthoic acid
2471-70-7 6-methoxy-2-naphthoic acid
| اسم المنتج |
6-methoxy-2-naphthoic acid |
| الاسم المستعار |
6-Methoxy-naphthalene-2-carboxylic acid; 6-methoxynaphthalene-2-carboxylate |
| الصيغة الجزيئية |
C12H9O3 |
| الوزن الجزيئي الغرامي |
201.1986 |
| InChI |
InChI=1/C12H10O3/c1-15-11-5-4-8-6-10(12(13)14)3-2-9(8)7-11/h2-7H,1H3,(H,13,14)/p-1 |
| إستراتيجية المساعدة القطرية |
2471-70-7 |
| بنية جزيئية |
|
| نقطة الغليان |
371.1°C at 760 mmHg |
| نقطة الوميض |
147.8°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
