ChemNet > CAS > 260-94-6 Acridine
260-94-6 Acridine
| اسم المنتج |
Acridine |
| الاسم المستعار |
Dibenzo[b,e]pyridine |
| الصيغة الجزيئية |
C13H9N |
| الوزن الجزيئي الغرامي |
179.2173 |
| InChI |
InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
| إستراتيجية المساعدة القطرية |
260-94-6 |
| المفوضية الأوروبية رقم |
205-971-6 |
| بنية جزيئية |
|
| كثافة |
1.187g/cm3 |
| درجة الإنصهار |
105-110℃ |
| نقطة الغليان |
346.7°C at 760 mmHg |
| معامل الإنكسار |
1.726 |
| نقطة الوميض |
153.8°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
