ChemNet > CAS > 261762-43-0 3-Chloro-2,6-difluorobenzoyl chloride
261762-43-0 3-Chloro-2,6-difluorobenzoyl chloride
اسم المنتج |
3-Chloro-2,6-difluorobenzoyl chloride |
الاسم بالانجليزية |
3-Chloro-2,6-difluorobenzoyl chloride; |
الصيغة الجزيئية |
C7H2Cl2F2O |
الوزن الجزيئي الغرامي |
210.993 |
InChI |
InChI=1/C7H2Cl2F2O/c8-3-1-2-4(10)5(6(3)11)7(9)12/h1-2H |
إستراتيجية المساعدة القطرية |
261762-43-0 |
بنية جزيئية |
|
كثافة |
1.548g/cm3 |
نقطة الغليان |
203.9°C at 760 mmHg |
معامل الإنكسار |
1.519 |
نقطة الوميض |
77.1°C |
ضغط البخار |
0.271mmHg at 25°C |
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|