ChemNet > CAS > 33577-16-1 Methyl methylsulfinylmethyl sulfide
33577-16-1 Methyl methylsulfinylmethyl sulfide
| اسم المنتج |
Methyl methylsulfinylmethyl sulfide |
| الاسم المستعار |
Methyl (methylthio)methyl sulphoxide; MMTS; Formaldehyde dimethyl thioacetal monoxide; Methyl (methylsulphinyl)methyl sulphide; (methylsulfanyl)(methylsulfinyl)methane; (methylsulfanyl)[(R)-methylsulfinyl]methane; (methylsulfanyl)[(S)-methylsulfinyl]methane |
| الصيغة الجزيئية |
C3H8OS2 |
| الوزن الجزيئي الغرامي |
124.225 |
| InChI |
InChI=1/C3H8OS2/c1-5-3-6(2)4/h3H2,1-2H3/t6-/m0/s1 |
| إستراتيجية المساعدة القطرية |
33577-16-1 |
| المفوضية الأوروبية رقم |
251-577-2 |
| بنية جزيئية |
|
| كثافة |
1.223g/cm3 |
| درجة الإنصهار |
222-226℃ |
| نقطة الغليان |
257.772°C at 760 mmHg |
| معامل الإنكسار |
1.56 |
| نقطة الوميض |
121.4°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|
