ChemNet > CAS > 33797-51-2 Eschenmoser's salt
33797-51-2 Eschenmoser's salt
اسم المنتج |
Eschenmoser's salt |
الاسم المستعار |
Dimethyl methyleneammonium iodide; Eschenmosers iodide salt; N,N-Dimethylmethyleneiminium iodide; Eschenmoser salt; N-methyl-N-methylidenemethanaminium iodide |
الصيغة الجزيئية |
C3H8IN |
الوزن الجزيئي الغرامي |
185.0068 |
InChI |
InChI=1/C3H8N.HI/c1-4(2)3;/h1H2,2-3H3;1H/q+1;/p-1 |
إستراتيجية المساعدة القطرية |
33797-51-2 |
المفوضية الأوروبية رقم |
251-680-2 |
بنية جزيئية |
|
درجة الإنصهار |
219℃ |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|