344-14-9 dimethyl fluoromalonate
اسم المنتج |
dimethyl fluoromalonate |
الاسم بالانجليزية |
dimethyl fluoromalonate; Fluoromalonic acid dimethyl ester; dimethyl fluoropropanedioate; 2-Fluoro-malonic acid dimethyl ester; Dimethyl 2-Fluoromalonate |
الصيغة الجزيئية |
C5H7FO4 |
الوزن الجزيئي الغرامي |
150.1051 |
InChI |
InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
إستراتيجية المساعدة القطرية |
344-14-9 |
بنية جزيئية |
|
كثافة |
1.211g/cm3 |
نقطة الغليان |
140.3°C at 760 mmHg |
معامل الإنكسار |
1.382 |
نقطة الوميض |
38.4°C |
ضغط البخار |
6.18mmHg at 25°C |
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|