ChemNet > CAS > 3556-83-0 Methyl 3-methoxy-4-methylbenzoate
3556-83-0 Methyl 3-methoxy-4-methylbenzoate
اسم المنتج |
Methyl 3-methoxy-4-methylbenzoate |
الاسم بالانجليزية |
Methyl 3-methoxy-4-methylbenzoate; 3-Methoxy-4-methylbenzoic acid methyl ester; 3-Methoxy-p-toluic acid methyl ester (COOCH3=1); methyl 4-methoxy-3-methylbenzoate |
الصيغة الجزيئية |
C10H12O3 |
الوزن الجزيئي الغرامي |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-7-6-8(10(11)13-3)4-5-9(7)12-2/h4-6H,1-3H3 |
إستراتيجية المساعدة القطرية |
3556-83-0 |
بنية جزيئية |
|
كثافة |
1.075g/cm3 |
درجة الإنصهار |
50-120℃ |
نقطة الغليان |
269.5°C at 760 mmHg |
معامل الإنكسار |
1.502 |
نقطة الوميض |
107.5°C |
ضغط البخار |
0.00723mmHg at 25°C |
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|