3562-73-0 1-(4-Biphenylyl)ethanol
اسم المنتج |
1-(4-Biphenylyl)ethanol |
الاسم بالانجليزية |
1-(4-Biphenylyl)ethanol; 4-Biphenylyl methyl carbinol~4-(1-Hydroxyethyl)biphenyl~alpha-Methyl-4-phenylbenzyl alcohol; 4-(1-Hydroxyethyl)biphenyl; 1-(biphenyl-4-yl)ethanol |
الصيغة الجزيئية |
C14H14O |
الوزن الجزيئي الغرامي |
198.2604 |
InChI |
InChI=1/C14H14O/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13/h2-11,15H,1H3 |
إستراتيجية المساعدة القطرية |
3562-73-0 |
المفوضية الأوروبية رقم |
222-629-1 |
بنية جزيئية |
|
كثافة |
1.067g/cm3 |
درجة الإنصهار |
95-97℃ |
نقطة الغليان |
340.4°C at 760 mmHg |
معامل الإنكسار |
1.581 |
نقطة الوميض |
148.6°C |
ضغط البخار |
3.34E-05mmHg at 25°C |
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|