ChemNet > CAS > 3879-08-1 4-Hydroxybutyric acid hydrazide
3879-08-1 4-Hydroxybutyric acid hydrazide
اسم المنتج |
4-Hydroxybutyric acid hydrazide |
الاسم بالانجليزية |
4-Hydroxybutyric acid hydrazide; 4-Hydroxybutanoic hydrazide; 4-hydroxybutanehydrazide |
الصيغة الجزيئية |
C4H10N2O2 |
الوزن الجزيئي الغرامي |
118.1344 |
InChI |
InChI=1/C4H10N2O2/c5-6-4(8)2-1-3-7/h7H,1-3,5H2,(H,6,8) |
إستراتيجية المساعدة القطرية |
3879-08-1 |
بنية جزيئية |
|
كثافة |
1.161g/cm3 |
درجة الإنصهار |
92-93℃ |
نقطة الغليان |
377.5°C at 760 mmHg |
معامل الإنكسار |
1.487 |
نقطة الوميض |
182.1°C |
ضغط البخار |
3.03E-07mmHg at 25°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|