55965-84-9;96118-96-6 Kathon 886
| اسم المنتج |
Kathon 886 |
| الاسم بالانجليزية |
Kathon 886; Kathon biocide; 5-Chloro-2-methyl-3(2H)-isothiazolone with 2-methyl-3(2H)-isothiazolone; Isothiazolinone; 5-Chloro-2-methyl-3(2H)-isothiazolone mixt. with 2-methyl-3(2H)-isothiazolone; 2-methyl-1,2-thiazol-3(2H)-one - 5-chloro-2-methyl-1,2-thiazol-3(2H)-one (1:1); CIT/MIT; Isothiazolinone (Mit, Cmit) |
| الصيغة الجزيئية |
C8H9ClN2O2S2 |
| الوزن الجزيئي الغرامي |
264.7523 |
| InChI |
InChI=1/C4H4ClNOS.C4H5NOS/c1-6-4(7)2-3(5)8-6;1-5-4(6)2-3-7-5/h2H,1H3;2-3H,1H3 |
| إستراتيجية المساعدة القطرية |
55965-84-9;96118-96-6 |
| بنية جزيئية |
|
| نقطة الغليان |
200.2°C at 760 mmHg |
| نقطة الوميض |
74.9°C |
| ضغط البخار |
0.328mmHg at 25°C |
|