ChemNet > CAS > 5720-05-8;917814-66-5 4-Methylbenzeneboronic acid
5720-05-8;917814-66-5 4-Methylbenzeneboronic acid
| اسم المنتج |
4-Methylbenzeneboronic acid |
| الاسم المستعار |
AKOS BRN-0019; 4-Tolylboronic Acid; 4-Tolyboronic Acid; 4-Methylphenylboric Acid; 4-Methylphenylboronic Acid; P-Methylphenylboronic Acid; P-Tolylboronic Acid; (4-Methylphenyl)Boronic Acid; (1R)-N-Methyl-1-Phenylethanamine |
| الصيغة الجزيئية |
C9H13N |
| الوزن الجزيئي الغرامي |
135.2062 |
| InChI |
InChI=1/C9H13N/c1-8(10-2)9-6-4-3-5-7-9/h3-8,10H,1-2H3/t8-/m1/s1 |
| إستراتيجية المساعدة القطرية |
5720-05-8;917814-66-5 |
| بنية جزيئية |
|
| كثافة |
0.911g/cm3 |
| درجة الإنصهار |
256-263℃ |
| نقطة الغليان |
178.7°C at 760 mmHg |
| معامل الإنكسار |
1.505 |
| نقطة الوميض |
61.6°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
