61-78-9 4-Aminohippuric acid
اسم المنتج |
4-Aminohippuric acid |
الاسم بالانجليزية |
4-Aminohippuric acid; PAH; p-Aminohippuric Acid (1.00084); 4-Aminohippuric acid = N-(4-Aminobenzoyl)-glycin; 4-Aminohippuric acid; [N-(4-Aminobenzoyl)glycine]; N-(4-Aminobenzoyl)glycine; N-(4-aminobenzoyl)-glycine; {[(4-aminophenyl)carbonyl]amino}acetate; p-Aminohippuric acid |
الصيغة الجزيئية |
C9H9N2O3 |
الوزن الجزيئي الغرامي |
193.1799 |
InChI |
InChI=1/C9H10N2O3/c10-7-3-1-6(2-4-7)9(14)11-5-8(12)13/h1-4H,5,10H2,(H,11,14)(H,12,13)/p-1 |
إستراتيجية المساعدة القطرية |
61-78-9 |
المفوضية الأوروبية رقم |
200-518-9 |
بنية جزيئية |
|
درجة الإنصهار |
197-200℃ |
نقطة الغليان |
517.2°C at 760 mmHg |
نقطة الوميض |
266.6°C |
ضغط البخار |
1.6E-11mmHg at 25°C |
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|