6793-92-6;152120-66-6 Benzyloxybromobenzene
| اسم المنتج |
Benzyloxybromobenzene |
| الاسم بالانجليزية |
Benzyloxybromobenzene; 1-Benzyloxy-4-bromobenzene; 1-Bromo-4-benzyloxybenzene; Benzyl 4-bromophenyl ether; 4-Benzyloxybromobenzene; 5-(TERT-BUTYLDIMETHYLSILYL)-1-METHYL-1H; 1-(Benzyloxy)-4-bromobenzene; Benzene, 1-bromo-4-(phenylmethoxy)-; Benzyl 4-bromophenyl ether; Benzyl p-bromophenyl ether |
| الصيغة الجزيئية |
C13H11BrO |
| الوزن الجزيئي الغرامي |
263.13 |
| InChI |
InChI=1/C13H11BrO/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| إستراتيجية المساعدة القطرية |
6793-92-6;152120-66-6 |
| بنية جزيئية |
|
| درجة الإنصهار |
60-63℃ |
| نقطة الغليان |
166-167℃ (4 mmHg) |
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|