ChemNet > CAS > 67973-32-4 3,5-Dibromo-4-methylbenzoic acid
67973-32-4 3,5-Dibromo-4-methylbenzoic acid
| اسم المنتج |
3,5-Dibromo-4-methylbenzoic acid |
| الاسم المستعار |
3,5-Dibromo-p-toluic acid (COOH=1); 3,5-Dibromo-p-toluic acid |
| الصيغة الجزيئية |
C8H6Br2O2 |
| الوزن الجزيئي الغرامي |
293.94 |
| InChI |
InChI=1/C8H6Br2O2/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,1H3,(H,11,12) |
| إستراتيجية المساعدة القطرية |
67973-32-4 |
| بنية جزيئية |
|
| كثافة |
1.951g/cm3 |
| نقطة الغليان |
374.6°C at 760 mmHg |
| معامل الإنكسار |
1.627 |
| نقطة الوميض |
180.3°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
