6836-19-7;6386-19-7 7-methoxy-1-tetralone
| اسم المنتج |
7-methoxy-1-tetralone |
| الاسم بالانجليزية |
7-methoxy-1-tetralone; 7-methoxy-1,2,3,4-tetrahydronaphthalen-1-one; 7-methoxyl-1-tetralone; 7-methoxy-3,4-dihydronaphthalen-1(2H)-one; 3,4-Dihydro-7-methoxy-1(2H)-naphthalenone; 7-Methoxy-1-Tetralone |
| الصيغة الجزيئية |
C11H12O2 |
| الوزن الجزيئي الغرامي |
176.2118 |
| InChI |
InChI=1/C11H12O2/c1-13-9-6-5-8-3-2-4-11(12)10(8)7-9/h5-7H,2-4H2,1H3 |
| إستراتيجية المساعدة القطرية |
6836-19-7;6386-19-7 |
| المفوضية الأوروبية رقم |
229-916-0 |
| بنية جزيئية |
|
| كثافة |
1.124g/cm3 |
| درجة الإنصهار |
59-63℃ |
| نقطة الغليان |
312.3°C at 760 mmHg |
| معامل الإنكسار |
1.548 |
| نقطة الوميض |
145.8°C |
| ضغط البخار |
0.000535mmHg at 25°C |
| شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|