ChemNet > CAS > 77876-39-2 (2S,4S)-(-)-2,4-Bis(diphenylphosphino)pentane
77876-39-2 (2S,4S)-(-)-2,4-Bis(diphenylphosphino)pentane
اسم المنتج |
(2S,4S)-(-)-2,4-Bis(diphenylphosphino)pentane |
الاسم المستعار |
BisdiphenylphosphinopentaneSSBDPPwhitex; (S,S)-BDPP; (2S,4S)-pentane-2,4-diylbis(diphenylphosphane); (2S,4S)-(-)-2,4-Bis(diphenylphosphino)pentane |
الصيغة الجزيئية |
C29H30P2 |
الوزن الجزيئي الغرامي |
440.496 |
InChI |
InChI=1/C29H30P2/c1-24(30(26-15-7-3-8-16-26)27-17-9-4-10-18-27)23-25(2)31(28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-22,24-25H,23H2,1-2H3/t24-,25-/m0/s1 |
إستراتيجية المساعدة القطرية |
77876-39-2 |
بنية جزيئية |
|
درجة الإنصهار |
81℃ |
نقطة الغليان |
543.8°C at 760 mmHg |
نقطة الوميض |
300.7°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|