ChemNet > CAS > 95735-63-0 2-(3,4-Dimethoxyphenylthio)acetic acid
95735-63-0 2-(3,4-Dimethoxyphenylthio)acetic acid
| اسم المنتج |
2-(3,4-Dimethoxyphenylthio)acetic acid |
| الاسم المستعار |
2-[(3,4-dimethoxyphenyl)thio]acetic acid; [(3,4-dimethoxyphenyl)sulfanyl]acetic acid; [(3,4-dimethoxyphenyl)sulfanyl]acetate |
| الصيغة الجزيئية |
C10H11O4S |
| الوزن الجزيئي الغرامي |
227.2575 |
| InChI |
InChI=1/C10H12O4S/c1-13-8-4-3-7(5-9(8)14-2)15-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
| إستراتيجية المساعدة القطرية |
95735-63-0 |
| بنية جزيئية |
|
| درجة الإنصهار |
101-103℃ |
| نقطة الغليان |
376.4°C at 760 mmHg |
| نقطة الوميض |
181.4°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
