ChemNet > CAS > 10534-89-1 Hexaaminecobalt(III) chloride
10534-89-1 Hexaaminecobalt(III) chloride
Ürün Adı |
Hexaaminecobalt(III) chloride |
Eş anlamlı |
Hexaamine cobalt(III) chloride; hexamminecobalttrichloride; Hexaamminecobalt (III) chloride; Hexamminecobalt(III) chloride; hexaamminecobalt trichloride; Hexaamminecobaltchlorideorangepowder; cobalt(3+) chloride ammoniate (1:3:6); azanide; cobalt |
Moleküler Formülü |
C6H12ClCoN4 |
Molekül Ağırlığı |
234.5719 |
InChI |
InChI=1/C6H12N4.ClH.Co/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h1-6H2;1H;/q;;+2/p-1 |
CAS kayıt numarası |
10534-89-1 |
EINECS |
234-103-9 |
Moleküler Yapısı |
|
Ergime noktası |
217℃ |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|