ChemNet > CAS > 111-80-8 Methyl 2-nonynoate
111-80-8 Methyl 2-nonynoate
| Ürün Adı |
Methyl 2-nonynoate |
| Eş anlamlı |
2-Nonynoic acid methyl ester; 2-Nonynoic acid, methyl ester; Methyl octin carbonate; Methyl octine carbonate; Octynecarboxylic acid, methyl ester; methyl non-2-ynoate |
| Moleküler Formülü |
C10H16O2 |
| Molekül Ağırlığı |
168.2328 |
| InChI |
InChI=1/C10H16O2/c1-3-4-5-6-7-8-9-10(11)12-2/h3-7H2,1-2H3 |
| CAS kayıt numarası |
111-80-8 |
| EINECS |
203-909-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.932g/cm3 |
| Kaynama noktası |
233.1°C at 760 mmHg |
| Kırılma indisi |
1.446 |
| Alevlenme noktası |
100.6°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
