ChemNet > CAS > 1119-60-4 6-heptenoic acid
1119-60-4 6-heptenoic acid
Ürün Adı |
6-heptenoic acid |
Eş anlamlı |
Hept-6-enoic acid |
Moleküler Formülü |
C7H12O2 |
Molekül Ağırlığı |
128.169 |
InChI |
InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h2H,1,3-6H2,(H,8,9) |
CAS kayıt numarası |
1119-60-4 |
EINECS |
214-283-5 |
Moleküler Yapısı |
|
Yoğunluk |
0.957g/cm3 |
Kaynama noktası |
226°C at 760 mmHg |
Kırılma indisi |
1.447 |
Alevlenme noktası |
113.3°C |
Tehlike Sembolleri |
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|