ChemNet > CAS > 1119-60-4 6-heptenoic acid
1119-60-4 6-heptenoic acid
| Ürün Adı |
6-heptenoic acid |
| Eş anlamlı |
Hept-6-enoic acid |
| Moleküler Formülü |
C7H12O2 |
| Molekül Ağırlığı |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h2H,1,3-6H2,(H,8,9) |
| CAS kayıt numarası |
1119-60-4 |
| EINECS |
214-283-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.957g/cm3 |
| Kaynama noktası |
226°C at 760 mmHg |
| Kırılma indisi |
1.447 |
| Alevlenme noktası |
113.3°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
