ChemNet > CAS > 1141-23-7 3-(4-Chlorophenyl)glutaramic acid
1141-23-7 3-(4-Chlorophenyl)glutaramic acid
Ürün Adı |
3-(4-Chlorophenyl)glutaramic acid |
Eş anlamlı |
3-(4-Chloro phenyl) Glutaric acid monoamide; 5-amino-3-(4-chlorophenyl)-5-oxopentanoic acid; β-(4-chlorophenyl)Glutarimide |
Moleküler Formülü |
C11H12ClNO3 |
Molekül Ağırlığı |
241.6709 |
InChI |
InChI=1/C11H12ClNO3/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H2,13,14)(H,15,16) |
CAS kayıt numarası |
1141-23-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.343g/cm3 |
Kaynama noktası |
494.9°C at 760 mmHg |
Kırılma indisi |
1.578 |
Alevlenme noktası |
253.1°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|