ChemNet > CAS > 117695-55-3 3,5-Dibromobenzeneboronic acid
117695-55-3 3,5-Dibromobenzeneboronic acid
| Ürün Adı |
3,5-Dibromobenzeneboronic acid |
| Eş anlamlı |
3,5-Dibromophenylboronic acid; 3,5-dibrombenzolboronsaeure; 3,5-Dibromophenyl boronic acid |
| Moleküler Formülü |
C6H5BBr2O2 |
| Molekül Ağırlığı |
279.7217 |
| InChI |
InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
| CAS kayıt numarası |
117695-55-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
2.09g/cm3 |
| Ergime noktası |
300℃ |
| Kaynama noktası |
382.8°C at 760 mmHg |
| Kırılma indisi |
1.651 |
| Alevlenme noktası |
185.3°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
