ChemNet > CAS > 117695-55-3 3,5-Dibromobenzeneboronic acid
117695-55-3 3,5-Dibromobenzeneboronic acid
Ürün Adı |
3,5-Dibromobenzeneboronic acid |
ingilizce adı |
3,5-Dibromobenzeneboronic acid; 3,5-Dibromophenylboronic acid; 3,5-dibrombenzolboronsaeure; 3,5-Dibromophenyl boronic acid |
Moleküler Formülü |
C6H5BBr2O2 |
Molekül Ağırlığı |
279.7217 |
InChI |
InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
CAS kayıt numarası |
117695-55-3 |
Moleküler Yapısı |
|
Yoğunluk |
2.09g/cm3 |
Ergime noktası |
300℃ |
Kaynama noktası |
382.8°C at 760 mmHg |
Kırılma indisi |
1.651 |
Alevlenme noktası |
185.3°C |
Buhar basıncı |
1.52E-06mmHg at 25°C |
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|