ChemNet > CAS > 130560-97-3 3-chloro-4-fluorothiobenzamide
130560-97-3 3-chloro-4-fluorothiobenzamide
Ürün Adı |
3-chloro-4-fluorothiobenzamide |
ingilizce adı |
3-chloro-4-fluorothiobenzamide; 3-Chloro-4-fluorobenzene-1-carbothioamide; 3-chloro-4-fluorobenzenecarbothioamide |
Moleküler Formülü |
C7H5ClFNS |
Molekül Ağırlığı |
189.6377 |
InChI |
InChI=1/C7H5ClFNS/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11) |
CAS kayıt numarası |
130560-97-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.434g/cm3 |
Ergime noktası |
129-130℃ |
Kaynama noktası |
285.5°C at 760 mmHg |
Kırılma indisi |
1.635 |
Alevlenme noktası |
126.5°C |
Buhar basıncı |
0.00279mmHg at 25°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/22:Harmful by inhalation and if swallowed.;
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|