ChemNet > CAS > 1643-28-3 3-(2-Chlorophenyl)propionic acid
1643-28-3 3-(2-Chlorophenyl)propionic acid
Ürün Adı |
3-(2-Chlorophenyl)propionic acid |
Eş anlamlı |
Benzenepropanoic acid, 2-chloro-; 2-Chlorobenzenepropanoic acid; 3-(2-chlorophenyl)propanoic acid; 3-(2-chlorophenyl)propanoate |
Moleküler Formülü |
C9H8ClO2 |
Molekül Ağırlığı |
183.6122 |
InChI |
InChI=1/C9H9ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
CAS kayıt numarası |
1643-28-3 |
Moleküler Yapısı |
|
Kaynama noktası |
306.6°C at 760 mmHg |
Alevlenme noktası |
139.2°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|