ChemNet > CAS > 1643-28-3 3-(2-Chlorophenyl)propionic acid
1643-28-3 3-(2-Chlorophenyl)propionic acid
| Ürün Adı |
3-(2-Chlorophenyl)propionic acid |
| Eş anlamlı |
Benzenepropanoic acid, 2-chloro-; 2-Chlorobenzenepropanoic acid; 3-(2-chlorophenyl)propanoic acid; 3-(2-chlorophenyl)propanoate |
| Moleküler Formülü |
C9H8ClO2 |
| Molekül Ağırlığı |
183.6122 |
| InChI |
InChI=1/C9H9ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
| CAS kayıt numarası |
1643-28-3 |
| Moleküler Yapısı |
|
| Kaynama noktası |
306.6°C at 760 mmHg |
| Alevlenme noktası |
139.2°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
