ChemNet > CAS > 17159-80-7 ethyl 4-hydroxycyclohexanecarboxylate
17159-80-7 ethyl 4-hydroxycyclohexanecarboxylate
Ürün Adı |
ethyl 4-hydroxycyclohexanecarboxylate |
Eş anlamlı |
Ethyl 4-hydroxycyclohexanecarboxylate,mixture of cis and trans; Ethyl 4-hydroxycyclohexane carboxylate |
Moleküler Formülü |
C9H16O3 |
Molekül Ağırlığı |
172.2215 |
InChI |
InChI=1/C9H16O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h7-8,10H,2-6H2,1H3 |
CAS kayıt numarası |
17159-80-7 |
EINECS |
241-215-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.093g/cm3 |
Kaynama noktası |
251.4°C at 760 mmHg |
Kırılma indisi |
1.481 |
Alevlenme noktası |
100.2°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
|
|