ChemNet > CAS > 18719-43-2 diethyl (3-chloropropyl)malonate
18719-43-2 diethyl (3-chloropropyl)malonate
| Ürün Adı |
diethyl (3-chloropropyl)malonate |
| Eş anlamlı |
(3-Chloropropyl)malonic acid diethyl ester; diethyl (3-chloropropyl)propanedioate |
| Moleküler Formülü |
C10H17ClO4 |
| Molekül Ağırlığı |
236.6926 |
| InChI |
InChI=1/C10H17ClO4/c1-3-14-9(12)8(6-5-7-11)10(13)15-4-2/h8H,3-7H2,1-2H3 |
| CAS kayıt numarası |
18719-43-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.114g/cm3 |
| Kaynama noktası |
290.2°C at 760 mmHg |
| Kırılma indisi |
1.447 |
| Alevlenme noktası |
111.9°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
