ChemNet > CAS > 216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
Ürün Adı |
4-Bromo-2-fluorobenzeneboronic acid |
Eş anlamlı |
4-Bromo-2-fluorophenylboronic acid |
Moleküler Formülü |
C6H5BBrFO2 |
Molekül Ağırlığı |
218.8161 |
InChI |
InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
CAS kayıt numarası |
216393-64-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.75g/cm3 |
Kaynama noktası |
310.6°C at 760 mmHg |
Kırılma indisi |
1.571 |
Alevlenme noktası |
141.6°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|