ChemNet > CAS > 2243-42-7 2-Phenoxybenzoic acid
2243-42-7 2-Phenoxybenzoic acid
| Ürün Adı |
2-Phenoxybenzoic acid |
| Eş anlamlı |
2-Carboxydiphenyl ether; 2-phenoxybenzoate |
| Moleküler Formülü |
C13H9O3 |
| Molekül Ağırlığı |
213.2093 |
| InChI |
InChI=1/C13H10O3/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9H,(H,14,15)/p-1 |
| CAS kayıt numarası |
2243-42-7 |
| EINECS |
218-811-5 |
| Moleküler Yapısı |
|
| Ergime noktası |
111-115℃ |
| Kaynama noktası |
343.3°C at 760 mmHg |
| Alevlenme noktası |
132°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
