ChemNet > CAS > 2293-07-4 1-(4-methoxyphenyl)-2-thiourea
2293-07-4 1-(4-methoxyphenyl)-2-thiourea
| Ürün Adı |
1-(4-methoxyphenyl)-2-thiourea |
| Eş anlamlı |
4-Methoxyphenylthiourea; 1-(4-methoxyphenyl)thiourea |
| Moleküler Formülü |
C8H10N2OS |
| Molekül Ağırlığı |
182.2428 |
| InChI |
InChI=1/C8H10N2OS/c1-11-7-4-2-6(3-5-7)10-8(9)12/h2-5H,1H3,(H3,9,10,12) |
| CAS kayıt numarası |
2293-07-4 |
| EINECS |
218-931-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.287g/cm3 |
| Ergime noktası |
212℃ |
| Kaynama noktası |
311°C at 760 mmHg |
| Kırılma indisi |
1.677 |
| Alevlenme noktası |
141.9°C |
| Tehlike Sembolleri |
 T:Toxic;
|
| Risk Kodları |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
