ChemNet > CAS > 25038-36-2 Ethylene/propylene/diene terpolymer
25038-36-2 Ethylene/propylene/diene terpolymer
Ürün Adı |
Ethylene/propylene/diene terpolymer |
Eş anlamlı |
Poly(ethylene-co-propylene-co-5-methylene-2-norbornene); ethylene; (5E)-5-ethylidenebicyclo[2.2.1]hept-2-ene; prop-1-ene; Ethylene Propylene Diene Monomer; EPDM;
|
Moleküler Formülü |
C14H22 |
Molekül Ağırlığı |
190.3245 |
InChI |
InChI=1/C9H12.C3H6.C2H4/c1-2-8-5-7-3-4-9(8)6-7;1-3-2;1-2/h2-4,7,9H,5-6H2,1H3;3H,1H2,2H3;1-2H2/b8-2+;; |
CAS kayıt numarası |
25038-36-2 |
Moleküler Yapısı |
|
Kaynama noktası |
146°C at 760 mmHg |
Alevlenme noktası |
34.2°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|