ChemNet > CAS > 25629-50-9 3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride
25629-50-9 3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride
Ürün Adı |
3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride |
Eş anlamlı |
3-(2-Chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride; 3-(o-Chlorophenyl)-5-methyl-4-isoxazolecarbonyl chloride; CMIC Chloride |
Moleküler Formülü |
C11H7Cl2NO2 |
Molekül Ağırlığı |
256.0848 |
InChI |
InChI=1/C11H7Cl2NO2/c1-6-9(11(13)15)10(14-16-6)7-4-2-3-5-8(7)12/h2-5H,1H3 |
CAS kayıt numarası |
25629-50-9 |
EINECS |
247-137-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.381g/cm3 |
Kaynama noktası |
381.7°C at 760 mmHg |
Kırılma indisi |
1.574 |
Alevlenme noktası |
184.6°C |
Tehlike Sembolleri |
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|