ChemNet > CAS > 30034-13-0 LK-Penicillin In Penicillin G The Derivatives
30034-13-0 LK-Penicillin In Penicillin G The Derivatives
| Ürün Adı |
LK-Penicillin In Penicillin G The Derivatives |
| ingilizce adı |
LK-Penicillin In Penicillin G The Derivatives; 4-Methoxybenzyl 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4-oxide; 4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-, (4-methoxyphenyl)methyl ester, 4-oxide; GEO: Penicillin-G-p-Methoxybenzyl ester Sulfoxide ; (4-methoxyphenyl)methyl 3,3-dimethyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4$l4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| Moleküler Formülü |
C24H26N2O6S |
| Molekül Ağırlığı |
470.538 |
| InChI |
InChI=1/C24H26N2O6S/c1-24(2)20(23(29)32-14-16-9-11-17(31-3)12-10-16)26-21(28)19(22(26)33(24)30)25-18(27)13-15-7-5-4-6-8-15/h4-12,19-20,22H,13-14H2,1-3H3,(H,25,27) |
| CAS kayıt numarası |
30034-13-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.39g/cm3 |
| Kaynama noktası |
765.5°C at 760 mmHg |
| Kırılma indisi |
1.652 |
| Alevlenme noktası |
416.8°C |
| Buhar basıncı |
2.42E-23mmHg at 25°C |
|