3017-95-6 2-bromo-1-chloropropane
Ürün Adı |
2-bromo-1-chloropropane |
ingilizce adı |
2-bromo-1-chloropropane;Propane, 2-bromo-1-chloro-; 1-Chloro-2-bromopropane; 2-Bromo-1-chloropropane; NSC 8022; (2S)-2-bromo-1-chloropropane |
Moleküler Formülü |
C3H6BrCl |
Molekül Ağırlığı |
157.4367 |
InChI |
InChI=1/C3H6BrCl/c1-3(4)2-5/h3H,2H2,1H3/t3-/m0/s1 |
CAS kayıt numarası |
3017-95-6 |
EINECS |
221-157-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.528g/cm3 |
Kaynama noktası |
115.3°C at 760 mmHg |
Kırılma indisi |
1.465 |
Alevlenme noktası |
27.6°C |
Buhar basıncı |
22.7mmHg at 25°C |
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|