ChemNet > CAS > 3160-35-8 4-Hydroxybenzal Acetone
3160-35-8 4-Hydroxybenzal Acetone
| Ürün Adı |
4-Hydroxybenzal Acetone |
| Eş anlamlı |
4-Hydroxybenzylidenacetone; 4-Hydroxybenzylideneacetone; 4-(4-hydroxyphenyl)but-3-en-2-one; (3E)-4-(4-hydroxyphenyl)but-3-en-2-one |
| Moleküler Formülü |
C10H10O2 |
| Molekül Ağırlığı |
162.1852 |
| InChI |
InChI=1/C10H10O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h2-7,12H,1H3/b3-2+ |
| CAS kayıt numarası |
3160-35-8 |
| EINECS |
221-607-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.138g/cm3 |
| Kaynama noktası |
318.1°C at 760 mmHg |
| Kırılma indisi |
1.599 |
| Alevlenme noktası |
134.8°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
